About [(Z)-[6-(cyanomethyl)cyclohexa-2,4-dien-1-ylidene]amino] 4-methylbenzenesulfonate
[(Z)-[6-(cyanomethyl)cyclohexa-2,4-dien-1-ylidene]amino] 4-methylbenzenesulfonate (PubChem CID 87855089) has the molecular formula C15H14N2O3S
and a molecular weight of 302.36 g/mol. Its IUPAC name is [(Z)-[6-(cyanomethyl)cyclohexa-2,4-dien-1-ylidene]amino] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [(Z)-[6-(cyanomethyl)cyclohexa-2,4-dien-1-ylidene]amino] 4-methylbenzenesulfonate |
| PubChem CID | 87855089 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | [(Z)-[6-(cyanomethyl)cyclohexa-2,4-dien-1-ylidene]amino] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O/N=C2/C=CC=CC2CC#N)cc1 |
| InChI | InChI=1S/C15H14N2O3S/c1-12-6-8-14(9-7-12)21(18,19)20-17-15-5-3-2-4-13(15)10-11-16/h2-9,13H,10H2,1H3/b17-15- |
| InChIKey | DYRWDFJPJBSKCH-ICFOKQHNSA-N |
| XLogP | 2.71 |
| TPSA | 79.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-[6-(cyanomethyl)cyclohexa-2,4-dien-1-ylidene]amino] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-[6-(cyanomethyl)cyclohexa-2,4-dien-1-ylidene]amino] 4-methylbenzenesulfonate?
The IUPAC name of [(Z)-[6-(cyanomethyl)cyclohexa-2,4-dien-1-ylidene]amino] 4-methylbenzenesulfonate (CID 87855089) is [(Z)-[6-(cyanomethyl)cyclohexa-2,4-dien-1-ylidene]amino] 4-methylbenzenesulfonate.
What is the SMILES notation for [(Z)-[6-(cyanomethyl)cyclohexa-2,4-dien-1-ylidene]amino] 4-methylbenzenesulfonate?
The canonical SMILES for [(Z)-[6-(cyanomethyl)cyclohexa-2,4-dien-1-ylidene]amino] 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)O/N=C2/C=CC=CC2CC#N)cc1.
What is the InChIKey of [(Z)-[6-(cyanomethyl)cyclohexa-2,4-dien-1-ylidene]amino] 4-methylbenzenesulfonate?
The InChIKey is DYRWDFJPJBSKCH-ICFOKQHNSA-N. The full InChI is InChI=1S/C15H14N2O3S/c1-12-6-8-14(9-7-12)21(18,19)20-17-15-5-3-2-4-13(15)10-11-16/h2-9,13H,10H2,1H3/b17-15-.
What are the key properties of [(Z)-[6-(cyanomethyl)cyclohexa-2,4-dien-1-ylidene]amino] 4-methylbenzenesulfonate?
[(Z)-[6-(cyanomethyl)cyclohexa-2,4-dien-1-ylidene]amino] 4-methylbenzenesulfonate has a molecular weight of 302.36 g/mol, XLogP of 2.71, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-[6-(cyanomethyl)cyclohexa-2,4-dien-1-ylidene]amino] 4-methylbenzenesulfonate is sourced from PubChem (CID 87855089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).