About 6-chloro-N-piperidin-4-ylthieno[3,2-c]pyridin-4-amine;dihydrochloride
6-chloro-N-piperidin-4-ylthieno[3,2-c]pyridin-4-amine;dihydrochloride (PubChem CID 87855093) has the molecular formula C12H16Cl3N3S
and a molecular weight of 340.71 g/mol. Its IUPAC name is 6-chloro-N-piperidin-4-ylthieno[3,2-c]pyridin-4-amine;dihydrochloride.
Molecular Properties
| Compound Name | 6-chloro-N-piperidin-4-ylthieno[3,2-c]pyridin-4-amine;dihydrochloride |
| PubChem CID | 87855093 |
| Molecular Formula | C12H16Cl3N3S |
| Molecular Weight | 340.71 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 6-chloro-N-piperidin-4-ylthieno[3,2-c]pyridin-4-amine;dihydrochloride |
| SMILES | Cl.Cl.Clc1cc2sccc2c(NC2CCNCC2)n1 |
| InChI | InChI=1S/C12H14ClN3S.2ClH/c13-11-7-10-9(3-6-17-10)12(16-11)15-8-1-4-14-5-2-8;;/h3,6-8,14H,1-2,4-5H2,(H,15,16);2*1H |
| InChIKey | XHMSQRWQWKAMFV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.71 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-N-piperidin-4-ylthieno[3,2-c]pyridin-4-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-piperidin-4-ylthieno[3,2-c]pyridin-4-amine;dihydrochloride?
The IUPAC name of 6-chloro-N-piperidin-4-ylthieno[3,2-c]pyridin-4-amine;dihydrochloride (CID 87855093) is 6-chloro-N-piperidin-4-ylthieno[3,2-c]pyridin-4-amine;dihydrochloride.
What is the SMILES notation for 6-chloro-N-piperidin-4-ylthieno[3,2-c]pyridin-4-amine;dihydrochloride?
The canonical SMILES for 6-chloro-N-piperidin-4-ylthieno[3,2-c]pyridin-4-amine;dihydrochloride is Cl.Cl.Clc1cc2sccc2c(NC2CCNCC2)n1.
What is the InChIKey of 6-chloro-N-piperidin-4-ylthieno[3,2-c]pyridin-4-amine;dihydrochloride?
The InChIKey is XHMSQRWQWKAMFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClN3S.2ClH/c13-11-7-10-9(3-6-17-10)12(16-11)15-8-1-4-14-5-2-8;;/h3,6-8,14H,1-2,4-5H2,(H,15,16);2*1H.
What are the key properties of 6-chloro-N-piperidin-4-ylthieno[3,2-c]pyridin-4-amine;dihydrochloride?
6-chloro-N-piperidin-4-ylthieno[3,2-c]pyridin-4-amine;dihydrochloride has a molecular weight of 340.71 g/mol, XLogP of 3.96, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-piperidin-4-ylthieno[3,2-c]pyridin-4-amine;dihydrochloride is sourced from PubChem (CID 87855093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).