C34H32F12N4O2 — CID 87855254
2-[4-[ethyl(pyridin-2-ylmethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;2-[4-[ethyl(pyridin-3-ylmethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 87855254) has the molecular formula C34H32F12N4O2 and a molecular weight of 756.63 g/mol. Its IUPAC name is 2-[4-[ethyl(pyridin-2-ylmethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;2-[4-[ethyl(pyridin-3-ylmethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[ethyl(pyridin-2-ylmethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;2-[4-[ethyl(pyridin-3-ylmethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 87855254 |
| Molecular Formula | C34H32F12N4O2 |
| Molecular Weight | 756.63 g/mol |
| Exact Mass | 756.23 |
| IUPAC Name | 2-[4-[ethyl(pyridin-2-ylmethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;2-[4-[ethyl(pyridin-3-ylmethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCN(Cc1ccccn1)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1.CCN(Cc1cccnc1)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/2C17H16F6N2O/c1-2-25(11-12-4-3-9-24-10-12)14-7-5-13(6-8-14)15(26,16(18,19)20)17(21,22)23;1-2-25(11-13-5-3-4-10-24-13)14-8-6-12(7-9-14)15(26,16(18,19)20)17(21,22)23/h2*3-10,26H,2,11H2,1H3 |
| InChIKey | UQRUKPCISHHFHB-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.63 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|