C31H31F6N3O5 — CID 87855325
tert-butyl N-[[3-[3-(6-ethyl-4-methyl-3-pyridinyl)phenyl]-3-oxopropanoyl]amino]-N-[3-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)phenyl]carbamate (PubChem CID 87855325) has the molecular formula C31H31F6N3O5 and a molecular weight of 639.59 g/mol. Its IUPAC name is tert-butyl N-[[3-[3-(6-ethyl-4-methyl-3-pyridinyl)phenyl]-3-oxopropanoyl]amino]-N-[3-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[[3-[3-(6-ethyl-4-methyl-3-pyridinyl)phenyl]-3-oxopropanoyl]amino]-N-[3-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 87855325 |
| Molecular Formula | C31H31F6N3O5 |
| Molecular Weight | 639.59 g/mol |
| Exact Mass | 639.22 |
| IUPAC Name | tert-butyl N-[[3-[3-(6-ethyl-4-methyl-3-pyridinyl)phenyl]-3-oxopropanoyl]amino]-N-[3-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)phenyl]carbamate |
| SMILES | CCc1cc(C)c(-c2cccc(C(=O)CC(=O)NN(C(=O)OC(C)(C)C)c3ccc(C(F)(F)F)c(OCC(F)(F)F)c3)c2)cn1 |
| InChI | InChI=1S/C31H31F6N3O5/c1-6-21-12-18(2)23(16-38-21)19-8-7-9-20(13-19)25(41)15-27(42)39-40(28(43)45-29(3,4)5)22-10-11-24(31(35,36)37)26(14-22)44-17-30(32,33)34/h7-14,16H,6,15,17H2,1-5H3,(H,39,42) |
| InChIKey | YHNZLTDYZNSWSJ-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.59 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|