About azane;4-chloro-6-(2,4,6-trimethylphenyl)pyrimidin-2-amine
azane;4-chloro-6-(2,4,6-trimethylphenyl)pyrimidin-2-amine (PubChem CID 87855847) has the molecular formula C13H17ClN4
and a molecular weight of 264.76 g/mol. Its IUPAC name is azane;4-chloro-6-(2,4,6-trimethylphenyl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | azane;4-chloro-6-(2,4,6-trimethylphenyl)pyrimidin-2-amine |
| PubChem CID | 87855847 |
| Molecular Formula | C13H17ClN4 |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | azane;4-chloro-6-(2,4,6-trimethylphenyl)pyrimidin-2-amine |
| SMILES | Cc1cc(C)c(-c2cc(Cl)nc(N)n2)c(C)c1.N |
| InChI | InChI=1S/C13H14ClN3.H3N/c1-7-4-8(2)12(9(3)5-7)10-6-11(14)17-13(15)16-10;/h4-6H,1-3H3,(H2,15,16,17);1H3 |
| InChIKey | OPJVVOQCKUUZBS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azane;4-chloro-6-(2,4,6-trimethylphenyl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4-chloro-6-(2,4,6-trimethylphenyl)pyrimidin-2-amine?
The IUPAC name of azane;4-chloro-6-(2,4,6-trimethylphenyl)pyrimidin-2-amine (CID 87855847) is azane;4-chloro-6-(2,4,6-trimethylphenyl)pyrimidin-2-amine.
What is the SMILES notation for azane;4-chloro-6-(2,4,6-trimethylphenyl)pyrimidin-2-amine?
The canonical SMILES for azane;4-chloro-6-(2,4,6-trimethylphenyl)pyrimidin-2-amine is Cc1cc(C)c(-c2cc(Cl)nc(N)n2)c(C)c1.N.
What is the InChIKey of azane;4-chloro-6-(2,4,6-trimethylphenyl)pyrimidin-2-amine?
The InChIKey is OPJVVOQCKUUZBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClN3.H3N/c1-7-4-8(2)12(9(3)5-7)10-6-11(14)17-13(15)16-10;/h4-6H,1-3H3,(H2,15,16,17);1H3.
What are the key properties of azane;4-chloro-6-(2,4,6-trimethylphenyl)pyrimidin-2-amine?
azane;4-chloro-6-(2,4,6-trimethylphenyl)pyrimidin-2-amine has a molecular weight of 264.76 g/mol, XLogP of 3.47, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-chloro-6-(2,4,6-trimethylphenyl)pyrimidin-2-amine is sourced from PubChem (CID 87855847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).