About 3-prop-2-ynylsulfonyloxypropyl prop-2-yne-1-sulfonate
3-prop-2-ynylsulfonyloxypropyl prop-2-yne-1-sulfonate (PubChem CID 87856346) has the molecular formula C9H12O6S2
and a molecular weight of 280.32 g/mol. Its IUPAC name is 3-prop-2-ynylsulfonyloxypropyl prop-2-yne-1-sulfonate.
Molecular Properties
| Compound Name | 3-prop-2-ynylsulfonyloxypropyl prop-2-yne-1-sulfonate |
| PubChem CID | 87856346 |
| Molecular Formula | C9H12O6S2 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 3-prop-2-ynylsulfonyloxypropyl prop-2-yne-1-sulfonate |
| SMILES | C#CCS(=O)(=O)OCCCOS(=O)(=O)CC#C |
| InChI | InChI=1S/C9H12O6S2/c1-3-8-16(10,11)14-6-5-7-15-17(12,13)9-4-2/h1-2H,5-9H2 |
| InChIKey | VZAHRVZJRLXTIN-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-prop-2-ynylsulfonyloxypropyl prop-2-yne-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-2-ynylsulfonyloxypropyl prop-2-yne-1-sulfonate?
The IUPAC name of 3-prop-2-ynylsulfonyloxypropyl prop-2-yne-1-sulfonate (CID 87856346) is 3-prop-2-ynylsulfonyloxypropyl prop-2-yne-1-sulfonate.
What is the SMILES notation for 3-prop-2-ynylsulfonyloxypropyl prop-2-yne-1-sulfonate?
The canonical SMILES for 3-prop-2-ynylsulfonyloxypropyl prop-2-yne-1-sulfonate is C#CCS(=O)(=O)OCCCOS(=O)(=O)CC#C.
What is the InChIKey of 3-prop-2-ynylsulfonyloxypropyl prop-2-yne-1-sulfonate?
The InChIKey is VZAHRVZJRLXTIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O6S2/c1-3-8-16(10,11)14-6-5-7-15-17(12,13)9-4-2/h1-2H,5-9H2.
What are the key properties of 3-prop-2-ynylsulfonyloxypropyl prop-2-yne-1-sulfonate?
3-prop-2-ynylsulfonyloxypropyl prop-2-yne-1-sulfonate has a molecular weight of 280.32 g/mol, XLogP of -0.66, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-2-ynylsulfonyloxypropyl prop-2-yne-1-sulfonate is sourced from PubChem (CID 87856346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).