C9H9F12N9O3 — CID 87856393
1,3,5-tris[1,2-bis(difluoroamino)ethyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 87856393) has the molecular formula C9H9F12N9O3 and a molecular weight of 519.21 g/mol. Its IUPAC name is 1,3,5-tris[1,2-bis(difluoroamino)ethyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris[1,2-bis(difluoroamino)ethyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 87856393 |
| Molecular Formula | C9H9F12N9O3 |
| Molecular Weight | 519.21 g/mol |
| Exact Mass | 519.06 |
| IUPAC Name | 1,3,5-tris[1,2-bis(difluoroamino)ethyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1n(C(CN(F)F)N(F)F)c(=O)n(C(CN(F)F)N(F)F)c(=O)n1C(CN(F)F)N(F)F |
| InChI | InChI=1S/C9H9F12N9O3/c10-22(11)1-4(28(16)17)25-7(31)26(5(29(18)19)2-23(12)13)9(33)27(8(25)32)6(30(20)21)3-24(14)15/h4-6H,1-3H2 |
| InChIKey | HTVBAFTYWKWPIV-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 85.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.21 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|