About 1-(2-cyclopenta-2,4-dien-1-ylethynyl)-3-iodobenzene
1-(2-cyclopenta-2,4-dien-1-ylethynyl)-3-iodobenzene (PubChem CID 87856458) has the molecular formula C13H9I
and a molecular weight of 292.12 g/mol. Its IUPAC name is 1-(2-cyclopenta-2,4-dien-1-ylethynyl)-3-iodobenzene.
Molecular Properties
| Compound Name | 1-(2-cyclopenta-2,4-dien-1-ylethynyl)-3-iodobenzene |
| PubChem CID | 87856458 |
| Molecular Formula | C13H9I |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 291.97 |
| IUPAC Name | 1-(2-cyclopenta-2,4-dien-1-ylethynyl)-3-iodobenzene |
| SMILES | Ic1cccc(C#CC2C=CC=C2)c1 |
| InChI | InChI=1S/C13H9I/c14-13-7-3-6-12(10-13)9-8-11-4-1-2-5-11/h1-7,10-11H |
| InChIKey | UXUIIJMMTLWAIV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-cyclopenta-2,4-dien-1-ylethynyl)-3-iodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-cyclopenta-2,4-dien-1-ylethynyl)-3-iodobenzene?
The IUPAC name of 1-(2-cyclopenta-2,4-dien-1-ylethynyl)-3-iodobenzene (CID 87856458) is 1-(2-cyclopenta-2,4-dien-1-ylethynyl)-3-iodobenzene.
What is the SMILES notation for 1-(2-cyclopenta-2,4-dien-1-ylethynyl)-3-iodobenzene?
The canonical SMILES for 1-(2-cyclopenta-2,4-dien-1-ylethynyl)-3-iodobenzene is Ic1cccc(C#CC2C=CC=C2)c1.
What is the InChIKey of 1-(2-cyclopenta-2,4-dien-1-ylethynyl)-3-iodobenzene?
The InChIKey is UXUIIJMMTLWAIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9I/c14-13-7-3-6-12(10-13)9-8-11-4-1-2-5-11/h1-7,10-11H.
What are the key properties of 1-(2-cyclopenta-2,4-dien-1-ylethynyl)-3-iodobenzene?
1-(2-cyclopenta-2,4-dien-1-ylethynyl)-3-iodobenzene has a molecular weight of 292.12 g/mol, XLogP of 3.38, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-cyclopenta-2,4-dien-1-ylethynyl)-3-iodobenzene is sourced from PubChem (CID 87856458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).