C23H24ClN5O3 — CID 87856521
3-[2-chloro-4-[3-[3-[(4-methoxyphenyl)methyl]-2-oxoimidazolidin-1-yl]pyrazol-1-yl]-6-methyl-3-pyridinyl]propanal (PubChem CID 87856521) has the molecular formula C23H24ClN5O3 and a molecular weight of 453.93 g/mol. Its IUPAC name is 3-[2-chloro-4-[3-[3-[(4-methoxyphenyl)methyl]-2-oxoimidazolidin-1-yl]pyrazol-1-yl]-6-methyl-3-pyridinyl]propanal.
| Compound Name | 3-[2-chloro-4-[3-[3-[(4-methoxyphenyl)methyl]-2-oxoimidazolidin-1-yl]pyrazol-1-yl]-6-methyl-3-pyridinyl]propanal |
|---|---|
| PubChem CID | 87856521 |
| Molecular Formula | C23H24ClN5O3 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 3-[2-chloro-4-[3-[3-[(4-methoxyphenyl)methyl]-2-oxoimidazolidin-1-yl]pyrazol-1-yl]-6-methyl-3-pyridinyl]propanal |
| SMILES | COc1ccc(CN2CCN(c3ccn(-c4cc(C)nc(Cl)c4CCC=O)n3)C2=O)cc1 |
| InChI | InChI=1S/C23H24ClN5O3/c1-16-14-20(19(4-3-13-30)22(24)25-16)29-10-9-21(26-29)28-12-11-27(23(28)31)15-17-5-7-18(32-2)8-6-17/h5-10,13-14H,3-4,11-12,15H2,1-2H3 |
| InChIKey | HZQZKPXUQMRCMZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|