C14H22F3N3O — CID 87856558
1-[3-(ethylamino)propyl]-3-[(2Z,4E)-4-(trifluoromethyl)hepta-2,4,6-trienyl]urea (PubChem CID 87856558) has the molecular formula C14H22F3N3O and a molecular weight of 305.34 g/mol. Its IUPAC name is 1-[3-(ethylamino)propyl]-3-[(2Z,4E)-4-(trifluoromethyl)hepta-2,4,6-trienyl]urea.
| Compound Name | 1-[3-(ethylamino)propyl]-3-[(2Z,4E)-4-(trifluoromethyl)hepta-2,4,6-trienyl]urea |
|---|---|
| PubChem CID | 87856558 |
| Molecular Formula | C14H22F3N3O |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 1-[3-(ethylamino)propyl]-3-[(2Z,4E)-4-(trifluoromethyl)hepta-2,4,6-trienyl]urea |
| SMILES | C=C/C=C(\C=C/CNC(=O)NCCCNCC)C(F)(F)F |
| InChI | InChI=1S/C14H22F3N3O/c1-3-7-12(14(15,16)17)8-5-10-19-13(21)20-11-6-9-18-4-2/h3,5,7-8,18H,1,4,6,9-11H2,2H3,(H2,19,20,21)/b8-5-,12-7+ |
| InChIKey | VNYLMMKSAGLJJW-VKLFPMIUSA-N |
| XLogP | 2.52 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|