C17H10BrF11O3S2 — CID 87856704
1-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-2-fluoro-2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propan-1-one (PubChem CID 87856704) has the molecular formula C17H10BrF11O3S2 and a molecular weight of 615.28 g/mol. Its IUPAC name is 1-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-2-fluoro-2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propan-1-one.
| Compound Name | 1-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-2-fluoro-2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propan-1-one |
|---|---|
| PubChem CID | 87856704 |
| Molecular Formula | C17H10BrF11O3S2 |
| Molecular Weight | 615.28 g/mol |
| Exact Mass | 613.91 |
| IUPAC Name | 1-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-2-fluoro-2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propan-1-one |
| SMILES | CC(F)(OC(F)(F)C(C)(F)OC(F)(F)C(F)(F)C(F)(F)F)C(=O)c1ccc(-c2ccc(Br)s2)s1 |
| InChI | InChI=1S/C17H10BrF11O3S2/c1-12(19,11(30)9-4-3-7(33-9)8-5-6-10(18)34-8)31-16(26,27)13(2,20)32-17(28,29)14(21,22)15(23,24)25/h3-6H,1-2H3 |
| InChIKey | NMBHAVYGJHIPCQ-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.28 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|