About 1-[methoxy-methyl-(2-methylpropyl)silyl]oxypropane-1,1-diamine
1-[methoxy-methyl-(2-methylpropyl)silyl]oxypropane-1,1-diamine (PubChem CID 87856826) has the molecular formula C9H24N2O2Si
and a molecular weight of 220.39 g/mol. Its IUPAC name is 1-[methoxy-methyl-(2-methylpropyl)silyl]oxypropane-1,1-diamine.
Molecular Properties
| Compound Name | 1-[methoxy-methyl-(2-methylpropyl)silyl]oxypropane-1,1-diamine |
| PubChem CID | 87856826 |
| Molecular Formula | C9H24N2O2Si |
| Molecular Weight | 220.39 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 1-[methoxy-methyl-(2-methylpropyl)silyl]oxypropane-1,1-diamine |
| SMILES | CCC(N)(N)O[Si](C)(CC(C)C)OC |
| InChI | InChI=1S/C9H24N2O2Si/c1-6-9(10,11)13-14(5,12-4)7-8(2)3/h8H,6-7,10-11H2,1-5H3 |
| InChIKey | SVSGVNLFCVYWRB-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[methoxy-methyl-(2-methylpropyl)silyl]oxypropane-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[methoxy-methyl-(2-methylpropyl)silyl]oxypropane-1,1-diamine?
The IUPAC name of 1-[methoxy-methyl-(2-methylpropyl)silyl]oxypropane-1,1-diamine (CID 87856826) is 1-[methoxy-methyl-(2-methylpropyl)silyl]oxypropane-1,1-diamine.
What is the SMILES notation for 1-[methoxy-methyl-(2-methylpropyl)silyl]oxypropane-1,1-diamine?
The canonical SMILES for 1-[methoxy-methyl-(2-methylpropyl)silyl]oxypropane-1,1-diamine is CCC(N)(N)O[Si](C)(CC(C)C)OC.
What is the InChIKey of 1-[methoxy-methyl-(2-methylpropyl)silyl]oxypropane-1,1-diamine?
The InChIKey is SVSGVNLFCVYWRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H24N2O2Si/c1-6-9(10,11)13-14(5,12-4)7-8(2)3/h8H,6-7,10-11H2,1-5H3.
What are the key properties of 1-[methoxy-methyl-(2-methylpropyl)silyl]oxypropane-1,1-diamine?
1-[methoxy-methyl-(2-methylpropyl)silyl]oxypropane-1,1-diamine has a molecular weight of 220.39 g/mol, XLogP of 1.36, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[methoxy-methyl-(2-methylpropyl)silyl]oxypropane-1,1-diamine is sourced from PubChem (CID 87856826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).