About hexyl(trimethyl)azanium;pentanoic acid
hexyl(trimethyl)azanium;pentanoic acid (PubChem CID 87857161) has the molecular formula C14H32NO2+
and a molecular weight of 246.41 g/mol. Its IUPAC name is hexyl(trimethyl)azanium;pentanoic acid.
Molecular Properties
| Compound Name | hexyl(trimethyl)azanium;pentanoic acid |
| PubChem CID | 87857161 |
| Molecular Formula | C14H32NO2+ |
| Molecular Weight | 246.41 g/mol |
| Exact Mass | 246.24 |
| IUPAC Name | hexyl(trimethyl)azanium;pentanoic acid |
| SMILES | CCCCC(=O)O.CCCCCC[N+](C)(C)C |
| InChI | InChI=1S/C9H22N.C5H10O2/c1-5-6-7-8-9-10(2,3)4;1-2-3-4-5(6)7/h5-9H2,1-4H3;2-4H2,1H3,(H,6,7)/q+1; |
| InChIKey | JFYHVUKLADUULD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze hexyl(trimethyl)azanium;pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl(trimethyl)azanium;pentanoic acid?
The IUPAC name of hexyl(trimethyl)azanium;pentanoic acid (CID 87857161) is hexyl(trimethyl)azanium;pentanoic acid.
What is the SMILES notation for hexyl(trimethyl)azanium;pentanoic acid?
The canonical SMILES for hexyl(trimethyl)azanium;pentanoic acid is CCCCC(=O)O.CCCCCC[N+](C)(C)C.
What is the InChIKey of hexyl(trimethyl)azanium;pentanoic acid?
The InChIKey is JFYHVUKLADUULD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N.C5H10O2/c1-5-6-7-8-9-10(2,3)4;1-2-3-4-5(6)7/h5-9H2,1-4H3;2-4H2,1H3,(H,6,7)/q+1;.
What are the key properties of hexyl(trimethyl)azanium;pentanoic acid?
hexyl(trimethyl)azanium;pentanoic acid has a molecular weight of 246.41 g/mol, XLogP of 3.53, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl(trimethyl)azanium;pentanoic acid is sourced from PubChem (CID 87857161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).