C26H21N — CID 87857753
(4aZ,8aZ,12aZ,16aE)-N,N-dimethyltetraphenylen-1-amine (PubChem CID 87857753) has the molecular formula C26H21N and a molecular weight of 347.46 g/mol. Its IUPAC name is (4aZ,8aZ,12aZ,16aE)-N,N-dimethyltetraphenylen-1-amine.
| Compound Name | (4aZ,8aZ,12aZ,16aE)-N,N-dimethyltetraphenylen-1-amine |
|---|---|
| PubChem CID | 87857753 |
| Molecular Formula | C26H21N |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (4aZ,8aZ,12aZ,16aE)-N,N-dimethyltetraphenylen-1-amine |
| SMILES | CN(C)c1cccc2/c1=c1/cccc/c1=c1\cccc\c1=c1/cccc/c1=2 |
| InChI | InChI=1S/C26H21N/c1-27(2)25-17-9-16-24-22-13-6-5-12-20(22)18-10-3-4-11-19(18)21-14-7-8-15-23(21)26(24)25/h3-17H,1-2H3/b20-18-,21-19-,24-22-,26-23+ |
| InChIKey | DZDMRQCHEVPFMT-NLBRCDLYSA-N |
| XLogP | 5.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |