About nickel;2-nitrosulfanylacetic acid
nickel;2-nitrosulfanylacetic acid (PubChem CID 87857790) has the molecular formula C2H3NNiO4S
and a molecular weight of 195.81 g/mol. Its IUPAC name is nickel;2-nitrosulfanylacetic acid.
Molecular Properties
| Compound Name | nickel;2-nitrosulfanylacetic acid |
| PubChem CID | 87857790 |
| Molecular Formula | C2H3NNiO4S |
| Molecular Weight | 195.81 g/mol |
| Exact Mass | 194.91 |
| IUPAC Name | nickel;2-nitrosulfanylacetic acid |
| SMILES | O=C(O)CS[N+](=O)[O-].[Ni] |
| InChI | InChI=1S/C2H3NO4S.Ni/c4-2(5)1-8-3(6)7;/h1H2,(H,4,5); |
| InChIKey | YZYWLCRHGZTSMO-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.81 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nickel;2-nitrosulfanylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel;2-nitrosulfanylacetic acid?
The IUPAC name of nickel;2-nitrosulfanylacetic acid (CID 87857790) is nickel;2-nitrosulfanylacetic acid.
What is the SMILES notation for nickel;2-nitrosulfanylacetic acid?
The canonical SMILES for nickel;2-nitrosulfanylacetic acid is O=C(O)CS[N+](=O)[O-].[Ni].
What is the InChIKey of nickel;2-nitrosulfanylacetic acid?
The InChIKey is YZYWLCRHGZTSMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3NO4S.Ni/c4-2(5)1-8-3(6)7;/h1H2,(H,4,5);.
What are the key properties of nickel;2-nitrosulfanylacetic acid?
nickel;2-nitrosulfanylacetic acid has a molecular weight of 195.81 g/mol, XLogP of -0.01, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nickel;2-nitrosulfanylacetic acid is sourced from PubChem (CID 87857790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).