C16H14Cl2F3NO6S — CID 87857803
6,7-dichloro-2-(2,2-dimethylpropyl)-1-oxo-4-(trifluoromethylsulfonyloxy)isoquinoline-3-carboxylic acid (PubChem CID 87857803) has the molecular formula C16H14Cl2F3NO6S and a molecular weight of 476.26 g/mol. Its IUPAC name is 6,7-dichloro-2-(2,2-dimethylpropyl)-1-oxo-4-(trifluoromethylsulfonyloxy)isoquinoline-3-carboxylic acid.
| Compound Name | 6,7-dichloro-2-(2,2-dimethylpropyl)-1-oxo-4-(trifluoromethylsulfonyloxy)isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 87857803 |
| Molecular Formula | C16H14Cl2F3NO6S |
| Molecular Weight | 476.26 g/mol |
| Exact Mass | 474.99 |
| IUPAC Name | 6,7-dichloro-2-(2,2-dimethylpropyl)-1-oxo-4-(trifluoromethylsulfonyloxy)isoquinoline-3-carboxylic acid |
| SMILES | CC(C)(C)Cn1c(C(=O)O)c(OS(=O)(=O)C(F)(F)F)c2cc(Cl)c(Cl)cc2c1=O |
| InChI | InChI=1S/C16H14Cl2F3NO6S/c1-15(2,3)6-22-11(14(24)25)12(28-29(26,27)16(19,20)21)7-4-9(17)10(18)5-8(7)13(22)23/h4-5H,6H2,1-3H3,(H,24,25) |
| InChIKey | KAAPYDXPBAFHPV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.26 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|