C20H27Cl2F3N2O5 — CID 87858187
[4-(3,4-dichlorophenyl)-6,7-dihydroxy-2,2-dimethyl-4-[[methyl-(2,2,2-trifluoroacetyl)amino]methyl]heptan-3-yl]carbamic acid (PubChem CID 87858187) has the molecular formula C20H27Cl2F3N2O5 and a molecular weight of 503.35 g/mol. Its IUPAC name is [4-(3,4-dichlorophenyl)-6,7-dihydroxy-2,2-dimethyl-4-[[methyl-(2,2,2-trifluoroacetyl)amino]methyl]heptan-3-yl]carbamic acid.
| Compound Name | [4-(3,4-dichlorophenyl)-6,7-dihydroxy-2,2-dimethyl-4-[[methyl-(2,2,2-trifluoroacetyl)amino]methyl]heptan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 87858187 |
| Molecular Formula | C20H27Cl2F3N2O5 |
| Molecular Weight | 503.35 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | [4-(3,4-dichlorophenyl)-6,7-dihydroxy-2,2-dimethyl-4-[[methyl-(2,2,2-trifluoroacetyl)amino]methyl]heptan-3-yl]carbamic acid |
| SMILES | CN(CC(CC(O)CO)(c1ccc(Cl)c(Cl)c1)C(NC(=O)O)C(C)(C)C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C20H27Cl2F3N2O5/c1-18(2,3)15(26-17(31)32)19(8-12(29)9-28,10-27(4)16(30)20(23,24)25)11-5-6-13(21)14(22)7-11/h5-7,12,15,26,28-29H,8-10H2,1-4H3,(H,31,32) |
| InChIKey | ISDNBWNOEAEYKA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |