About 1-N-iodo-2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine
1-N-iodo-2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine (PubChem CID 87858430) has the molecular formula C9H18IN5O
and a molecular weight of 339.18 g/mol. Its IUPAC name is 1-N-iodo-2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine.
Molecular Properties
| Compound Name | 1-N-iodo-2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine |
| PubChem CID | 87858430 |
| Molecular Formula | C9H18IN5O |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 1-N-iodo-2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine |
| SMILES | INN1CCN=C1NCCN1CCOCC1 |
| InChI | InChI=1S/C9H18IN5O/c10-13-15-4-2-12-9(15)11-1-3-14-5-7-16-8-6-14/h13H,1-8H2,(H,11,12) |
| InChIKey | BEYALYOITMUWQM-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-N-iodo-2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-iodo-2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine?
The IUPAC name of 1-N-iodo-2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine (CID 87858430) is 1-N-iodo-2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine.
What is the SMILES notation for 1-N-iodo-2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine?
The canonical SMILES for 1-N-iodo-2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine is INN1CCN=C1NCCN1CCOCC1.
What is the InChIKey of 1-N-iodo-2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine?
The InChIKey is BEYALYOITMUWQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18IN5O/c10-13-15-4-2-12-9(15)11-1-3-14-5-7-16-8-6-14/h13H,1-8H2,(H,11,12).
What are the key properties of 1-N-iodo-2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine?
1-N-iodo-2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine has a molecular weight of 339.18 g/mol, XLogP of -0.57, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-iodo-2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine is sourced from PubChem (CID 87858430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).