C11H18N2 — CID 87858451
1-(1,2a,5,6,6a,7-hexahydroazirino[1,2-a]indol-7a-yl)ethanamine (PubChem CID 87858451) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 1-(1,2a,5,6,6a,7-hexahydroazirino[1,2-a]indol-7a-yl)ethanamine.
| Compound Name | 1-(1,2a,5,6,6a,7-hexahydroazirino[1,2-a]indol-7a-yl)ethanamine |
|---|---|
| PubChem CID | 87858451 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 1-(1,2a,5,6,6a,7-hexahydroazirino[1,2-a]indol-7a-yl)ethanamine |
| SMILES | CC(N)C12CC3CCC=CC3N1C2 |
| InChI | InChI=1S/C11H18N2/c1-8(12)11-6-9-4-2-3-5-10(9)13(11)7-11/h3,5,8-10H,2,4,6-7,12H2,1H3 |
| InChIKey | LPVINGJSVCTEGS-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 29.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|