About 2-(hydroxymethyl)pentane-1,5-diol;isocyanic acid
2-(hydroxymethyl)pentane-1,5-diol;isocyanic acid (PubChem CID 87858570) has the molecular formula C7H15NO4
and a molecular weight of 177.20 g/mol. Its IUPAC name is 2-(hydroxymethyl)pentane-1,5-diol;isocyanic acid.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)pentane-1,5-diol;isocyanic acid |
| PubChem CID | 87858570 |
| Molecular Formula | C7H15NO4 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 2-(hydroxymethyl)pentane-1,5-diol;isocyanic acid |
| SMILES | N=C=O.OCCCC(CO)CO |
| InChI | InChI=1S/C6H14O3.CHNO/c7-3-1-2-6(4-8)5-9;2-1-3/h6-9H,1-5H2;2H |
| InChIKey | JBNVXFDOVQTLCD-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 101.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-(hydroxymethyl)pentane-1,5-diol;isocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)pentane-1,5-diol;isocyanic acid?
The IUPAC name of 2-(hydroxymethyl)pentane-1,5-diol;isocyanic acid (CID 87858570) is 2-(hydroxymethyl)pentane-1,5-diol;isocyanic acid.
What is the SMILES notation for 2-(hydroxymethyl)pentane-1,5-diol;isocyanic acid?
The canonical SMILES for 2-(hydroxymethyl)pentane-1,5-diol;isocyanic acid is N=C=O.OCCCC(CO)CO.
What is the InChIKey of 2-(hydroxymethyl)pentane-1,5-diol;isocyanic acid?
The InChIKey is JBNVXFDOVQTLCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O3.CHNO/c7-3-1-2-6(4-8)5-9;2-1-3/h6-9H,1-5H2;2H.
What are the key properties of 2-(hydroxymethyl)pentane-1,5-diol;isocyanic acid?
2-(hydroxymethyl)pentane-1,5-diol;isocyanic acid has a molecular weight of 177.20 g/mol, XLogP of -0.74, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)pentane-1,5-diol;isocyanic acid is sourced from PubChem (CID 87858570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).