About (2-nitrophenyl)methyl 2-chloroacetate
(2-nitrophenyl)methyl 2-chloroacetate (PubChem CID 87858601) has the molecular formula C9H8ClNO4
and a molecular weight of 229.62 g/mol. Its IUPAC name is (2-nitrophenyl)methyl 2-chloroacetate.
Molecular Properties
| Compound Name | (2-nitrophenyl)methyl 2-chloroacetate |
| PubChem CID | 87858601 |
| Molecular Formula | C9H8ClNO4 |
| Molecular Weight | 229.62 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | (2-nitrophenyl)methyl 2-chloroacetate |
| SMILES | O=C(CCl)OCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H8ClNO4/c10-5-9(12)15-6-7-3-1-2-4-8(7)11(13)14/h1-4H,5-6H2 |
| InChIKey | YYDXDIHGRWJHLV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.62 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-nitrophenyl)methyl 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-nitrophenyl)methyl 2-chloroacetate?
The IUPAC name of (2-nitrophenyl)methyl 2-chloroacetate (CID 87858601) is (2-nitrophenyl)methyl 2-chloroacetate.
What is the SMILES notation for (2-nitrophenyl)methyl 2-chloroacetate?
The canonical SMILES for (2-nitrophenyl)methyl 2-chloroacetate is O=C(CCl)OCc1ccccc1[N+](=O)[O-].
What is the InChIKey of (2-nitrophenyl)methyl 2-chloroacetate?
The InChIKey is YYDXDIHGRWJHLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClNO4/c10-5-9(12)15-6-7-3-1-2-4-8(7)11(13)14/h1-4H,5-6H2.
What are the key properties of (2-nitrophenyl)methyl 2-chloroacetate?
(2-nitrophenyl)methyl 2-chloroacetate has a molecular weight of 229.62 g/mol, XLogP of 1.88, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-nitrophenyl)methyl 2-chloroacetate is sourced from PubChem (CID 87858601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).