About bis(2,9-dimethylpentadecyl) sulfate
bis(2,9-dimethylpentadecyl) sulfate (PubChem CID 87858642) has the molecular formula C34H70O4S
and a molecular weight of 575.00 g/mol. Its IUPAC name is bis(2,9-dimethylpentadecyl) sulfate.
Molecular Properties
| Compound Name | bis(2,9-dimethylpentadecyl) sulfate |
| PubChem CID | 87858642 |
| Molecular Formula | C34H70O4S |
| Molecular Weight | 575.00 g/mol |
| Exact Mass | 574.50 |
| IUPAC Name | bis(2,9-dimethylpentadecyl) sulfate |
| SMILES | CCCCCCC(C)CCCCCCC(C)COS(=O)(=O)OCC(C)CCCCCCC(C)CCCCCC |
| InChI | InChI=1S/C34H70O4S/c1-7-9-11-17-23-31(3)25-19-13-15-21-27-33(5)29-37-39(35,36)38-30-34(6)28-22-16-14-20-26-32(4)24-18-12-10-8-2/h31-34H,7-30H2,1-6H3 |
| InChIKey | BIVPMMYAUPVVMF-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 575.00 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(2,9-dimethylpentadecyl) sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,9-dimethylpentadecyl) sulfate?
The IUPAC name of bis(2,9-dimethylpentadecyl) sulfate (CID 87858642) is bis(2,9-dimethylpentadecyl) sulfate.
What is the SMILES notation for bis(2,9-dimethylpentadecyl) sulfate?
The canonical SMILES for bis(2,9-dimethylpentadecyl) sulfate is CCCCCCC(C)CCCCCCC(C)COS(=O)(=O)OCC(C)CCCCCCC(C)CCCCCC.
What is the InChIKey of bis(2,9-dimethylpentadecyl) sulfate?
The InChIKey is BIVPMMYAUPVVMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H70O4S/c1-7-9-11-17-23-31(3)25-19-13-15-21-27-33(5)29-37-39(35,36)38-30-34(6)28-22-16-14-20-26-32(4)24-18-12-10-8-2/h31-34H,7-30H2,1-6H3.
What are the key properties of bis(2,9-dimethylpentadecyl) sulfate?
bis(2,9-dimethylpentadecyl) sulfate has a molecular weight of 575.00 g/mol, XLogP of 11.43, 30 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,9-dimethylpentadecyl) sulfate is sourced from PubChem (CID 87858642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).