C20H20N4 — CID 87858650
5-diazo-1-[[1-[(5-diazocyclohexa-1,3-dien-1-yl)methyl]cyclohexa-2,4-dien-1-yl]methyl]cyclohexa-1,3-diene (PubChem CID 87858650) has the molecular formula C20H20N4 and a molecular weight of 316.41 g/mol. Its IUPAC name is 5-diazo-1-[[1-[(5-diazocyclohexa-1,3-dien-1-yl)methyl]cyclohexa-2,4-dien-1-yl]methyl]cyclohexa-1,3-diene.
| Compound Name | 5-diazo-1-[[1-[(5-diazocyclohexa-1,3-dien-1-yl)methyl]cyclohexa-2,4-dien-1-yl]methyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 87858650 |
| Molecular Formula | C20H20N4 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 5-diazo-1-[[1-[(5-diazocyclohexa-1,3-dien-1-yl)methyl]cyclohexa-2,4-dien-1-yl]methyl]cyclohexa-1,3-diene |
| SMILES | [N-]=[N+]=C1C=CC=C(CC2(CC3=CC=CC(=[N+]=[N-])C3)C=CC=CC2)C1 |
| InChI | InChI=1S/C20H20N4/c21-23-18-8-4-6-16(12-18)14-20(10-2-1-3-11-20)15-17-7-5-9-19(13-17)24-22/h1-10H,11-15H2 |
| InChIKey | GVGWKECBFSAUFG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|