About 2-hydroxybenzenesulfonic acid;3-hydroxy-2-methoxybenzenesulfonic acid
2-hydroxybenzenesulfonic acid;3-hydroxy-2-methoxybenzenesulfonic acid (PubChem CID 87858666) has the molecular formula C13H14O9S2
and a molecular weight of 378.38 g/mol. Its IUPAC name is 2-hydroxybenzenesulfonic acid;3-hydroxy-2-methoxybenzenesulfonic acid.
Molecular Properties
| Compound Name | 2-hydroxybenzenesulfonic acid;3-hydroxy-2-methoxybenzenesulfonic acid |
| PubChem CID | 87858666 |
| Molecular Formula | C13H14O9S2 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 2-hydroxybenzenesulfonic acid;3-hydroxy-2-methoxybenzenesulfonic acid |
| SMILES | COc1c(O)cccc1S(=O)(=O)O.O=S(=O)(O)c1ccccc1O |
| InChI | InChI=1S/C7H8O5S.C6H6O4S/c1-12-7-5(8)3-2-4-6(7)13(9,10)11;7-5-3-1-2-4-6(5)11(8,9)10/h2-4,8H,1H3,(H,9,10,11);1-4,7H,(H,8,9,10) |
| InChIKey | QVHSNYRJLVEYAV-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxybenzenesulfonic acid;3-hydroxy-2-methoxybenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybenzenesulfonic acid;3-hydroxy-2-methoxybenzenesulfonic acid?
The IUPAC name of 2-hydroxybenzenesulfonic acid;3-hydroxy-2-methoxybenzenesulfonic acid (CID 87858666) is 2-hydroxybenzenesulfonic acid;3-hydroxy-2-methoxybenzenesulfonic acid.
What is the SMILES notation for 2-hydroxybenzenesulfonic acid;3-hydroxy-2-methoxybenzenesulfonic acid?
The canonical SMILES for 2-hydroxybenzenesulfonic acid;3-hydroxy-2-methoxybenzenesulfonic acid is COc1c(O)cccc1S(=O)(=O)O.O=S(=O)(O)c1ccccc1O.
What is the InChIKey of 2-hydroxybenzenesulfonic acid;3-hydroxy-2-methoxybenzenesulfonic acid?
The InChIKey is QVHSNYRJLVEYAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O5S.C6H6O4S/c1-12-7-5(8)3-2-4-6(7)13(9,10)11;7-5-3-1-2-4-6(5)11(8,9)10/h2-4,8H,1H3,(H,9,10,11);1-4,7H,(H,8,9,10).
What are the key properties of 2-hydroxybenzenesulfonic acid;3-hydroxy-2-methoxybenzenesulfonic acid?
2-hydroxybenzenesulfonic acid;3-hydroxy-2-methoxybenzenesulfonic acid has a molecular weight of 378.38 g/mol, XLogP of 1.29, 3 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybenzenesulfonic acid;3-hydroxy-2-methoxybenzenesulfonic acid is sourced from PubChem (CID 87858666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).