C16H16N2O4 — CID 87858757
2-[4-[[(2S)-oxiran-2-yl]methoxy]-1-benzofuran-2-yl]-5-propan-2-yl-1,3,4-oxadiazole (PubChem CID 87858757) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is 2-[4-[[(2S)-oxiran-2-yl]methoxy]-1-benzofuran-2-yl]-5-propan-2-yl-1,3,4-oxadiazole.
| Compound Name | 2-[4-[[(2S)-oxiran-2-yl]methoxy]-1-benzofuran-2-yl]-5-propan-2-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 87858757 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-[4-[[(2S)-oxiran-2-yl]methoxy]-1-benzofuran-2-yl]-5-propan-2-yl-1,3,4-oxadiazole |
| SMILES | CC(C)c1nnc(-c2cc3c(OC[C@@H]4CO4)cccc3o2)o1 |
| InChI | InChI=1S/C16H16N2O4/c1-9(2)15-17-18-16(22-15)14-6-11-12(20-8-10-7-19-10)4-3-5-13(11)21-14/h3-6,9-10H,7-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | NYHSLCYFLMALEK-JTQLQIEISA-N |
| XLogP | 3.38 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|