C30H42N2NiS2 — CID 87859087
2-N-(2,5-ditert-butylphenyl)-3-N-[2,6-di(propan-2-yl)phenyl]-1,4-dithiane-2,3-diimine;nickel (PubChem CID 87859087) has the molecular formula C30H42N2NiS2 and a molecular weight of 553.51 g/mol. Its IUPAC name is 2-N-(2,5-ditert-butylphenyl)-3-N-[2,6-di(propan-2-yl)phenyl]-1,4-dithiane-2,3-diimine;nickel.
| Compound Name | 2-N-(2,5-ditert-butylphenyl)-3-N-[2,6-di(propan-2-yl)phenyl]-1,4-dithiane-2,3-diimine;nickel |
|---|---|
| PubChem CID | 87859087 |
| Molecular Formula | C30H42N2NiS2 |
| Molecular Weight | 553.51 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | 2-N-(2,5-ditert-butylphenyl)-3-N-[2,6-di(propan-2-yl)phenyl]-1,4-dithiane-2,3-diimine;nickel |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C1\SCCS\C1=N/c1cc(C(C)(C)C)ccc1C(C)(C)C.[Ni] |
| InChI | InChI=1S/C30H42N2S2.Ni/c1-19(2)22-12-11-13-23(20(3)4)26(22)32-28-27(33-16-17-34-28)31-25-18-21(29(5,6)7)14-15-24(25)30(8,9)10;/h11-15,18-20H,16-17H2,1-10H3;/b31-27-,32-28-; |
| InChIKey | SZXZCPABLPLVAJ-LWCZPEMSSA-N |
| XLogP | 9.77 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.51 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|