About (2,3-diethoxy-6-hydroxy-4,5-dimethylphenyl) hydrogen carbonate
(2,3-diethoxy-6-hydroxy-4,5-dimethylphenyl) hydrogen carbonate (PubChem CID 87859446) has the molecular formula C13H18O6
and a molecular weight of 270.28 g/mol. Its IUPAC name is (2,3-diethoxy-6-hydroxy-4,5-dimethylphenyl) hydrogen carbonate.
Molecular Properties
| Compound Name | (2,3-diethoxy-6-hydroxy-4,5-dimethylphenyl) hydrogen carbonate |
| PubChem CID | 87859446 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | (2,3-diethoxy-6-hydroxy-4,5-dimethylphenyl) hydrogen carbonate |
| SMILES | CCOc1c(C)c(C)c(O)c(OC(=O)O)c1OCC |
| InChI | InChI=1S/C13H18O6/c1-5-17-10-8(4)7(3)9(14)11(19-13(15)16)12(10)18-6-2/h14H,5-6H2,1-4H3,(H,15,16) |
| InChIKey | ZXFNTVSGVYLTMU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (2,3-diethoxy-6-hydroxy-4,5-dimethylphenyl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-diethoxy-6-hydroxy-4,5-dimethylphenyl) hydrogen carbonate?
The IUPAC name of (2,3-diethoxy-6-hydroxy-4,5-dimethylphenyl) hydrogen carbonate (CID 87859446) is (2,3-diethoxy-6-hydroxy-4,5-dimethylphenyl) hydrogen carbonate.
What is the SMILES notation for (2,3-diethoxy-6-hydroxy-4,5-dimethylphenyl) hydrogen carbonate?
The canonical SMILES for (2,3-diethoxy-6-hydroxy-4,5-dimethylphenyl) hydrogen carbonate is CCOc1c(C)c(C)c(O)c(OC(=O)O)c1OCC.
What is the InChIKey of (2,3-diethoxy-6-hydroxy-4,5-dimethylphenyl) hydrogen carbonate?
The InChIKey is ZXFNTVSGVYLTMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O6/c1-5-17-10-8(4)7(3)9(14)11(19-13(15)16)12(10)18-6-2/h14H,5-6H2,1-4H3,(H,15,16).
What are the key properties of (2,3-diethoxy-6-hydroxy-4,5-dimethylphenyl) hydrogen carbonate?
(2,3-diethoxy-6-hydroxy-4,5-dimethylphenyl) hydrogen carbonate has a molecular weight of 270.28 g/mol, XLogP of 2.86, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-diethoxy-6-hydroxy-4,5-dimethylphenyl) hydrogen carbonate is sourced from PubChem (CID 87859446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).