About trimethoxy-[2-methyl-3,6,6-tri(propan-2-yl)-9-trimethoxysilylnonan-3-yl]silane
trimethoxy-[2-methyl-3,6,6-tri(propan-2-yl)-9-trimethoxysilylnonan-3-yl]silane (PubChem CID 87859458) has the molecular formula C25H56O6Si2
and a molecular weight of 508.89 g/mol. Its IUPAC name is trimethoxy-[2-methyl-3,6,6-tri(propan-2-yl)-9-trimethoxysilylnonan-3-yl]silane.
Molecular Properties
| Compound Name | trimethoxy-[2-methyl-3,6,6-tri(propan-2-yl)-9-trimethoxysilylnonan-3-yl]silane |
| PubChem CID | 87859458 |
| Molecular Formula | C25H56O6Si2 |
| Molecular Weight | 508.89 g/mol |
| Exact Mass | 508.36 |
| IUPAC Name | trimethoxy-[2-methyl-3,6,6-tri(propan-2-yl)-9-trimethoxysilylnonan-3-yl]silane |
| SMILES | CO[Si](CCCC(CCC(C(C)C)(C(C)C)[Si](OC)(OC)OC)(C(C)C)C(C)C)(OC)OC |
| InChI | InChI=1S/C25H56O6Si2/c1-20(2)24(21(3)4,16-15-19-32(26-9,27-10)28-11)17-18-25(22(5)6,23(7)8)33(29-12,30-13)31-14/h20-23H,15-19H2,1-14H3 |
| InChIKey | QZTSQVYRPYOYDT-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.89 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethoxy-[2-methyl-3,6,6-tri(propan-2-yl)-9-trimethoxysilylnonan-3-yl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethoxy-[2-methyl-3,6,6-tri(propan-2-yl)-9-trimethoxysilylnonan-3-yl]silane?
The IUPAC name of trimethoxy-[2-methyl-3,6,6-tri(propan-2-yl)-9-trimethoxysilylnonan-3-yl]silane (CID 87859458) is trimethoxy-[2-methyl-3,6,6-tri(propan-2-yl)-9-trimethoxysilylnonan-3-yl]silane.
What is the SMILES notation for trimethoxy-[2-methyl-3,6,6-tri(propan-2-yl)-9-trimethoxysilylnonan-3-yl]silane?
The canonical SMILES for trimethoxy-[2-methyl-3,6,6-tri(propan-2-yl)-9-trimethoxysilylnonan-3-yl]silane is CO[Si](CCCC(CCC(C(C)C)(C(C)C)[Si](OC)(OC)OC)(C(C)C)C(C)C)(OC)OC.
What is the InChIKey of trimethoxy-[2-methyl-3,6,6-tri(propan-2-yl)-9-trimethoxysilylnonan-3-yl]silane?
The InChIKey is QZTSQVYRPYOYDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H56O6Si2/c1-20(2)24(21(3)4,16-15-19-32(26-9,27-10)28-11)17-18-25(22(5)6,23(7)8)33(29-12,30-13)31-14/h20-23H,15-19H2,1-14H3.
What are the key properties of trimethoxy-[2-methyl-3,6,6-tri(propan-2-yl)-9-trimethoxysilylnonan-3-yl]silane?
trimethoxy-[2-methyl-3,6,6-tri(propan-2-yl)-9-trimethoxysilylnonan-3-yl]silane has a molecular weight of 508.89 g/mol, XLogP of 6.65, 18 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for trimethoxy-[2-methyl-3,6,6-tri(propan-2-yl)-9-trimethoxysilylnonan-3-yl]silane is sourced from PubChem (CID 87859458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).