About (4,5-dibromo-2-hydroxy-3,6-dimethylphenyl) hydrogen carbonate
(4,5-dibromo-2-hydroxy-3,6-dimethylphenyl) hydrogen carbonate (PubChem CID 87859965) has the molecular formula C9H8Br2O4
and a molecular weight of 339.97 g/mol. Its IUPAC name is (4,5-dibromo-2-hydroxy-3,6-dimethylphenyl) hydrogen carbonate.
Molecular Properties
| Compound Name | (4,5-dibromo-2-hydroxy-3,6-dimethylphenyl) hydrogen carbonate |
| PubChem CID | 87859965 |
| Molecular Formula | C9H8Br2O4 |
| Molecular Weight | 339.97 g/mol |
| Exact Mass | 337.88 |
| IUPAC Name | (4,5-dibromo-2-hydroxy-3,6-dimethylphenyl) hydrogen carbonate |
| SMILES | Cc1c(O)c(OC(=O)O)c(C)c(Br)c1Br |
| InChI | InChI=1S/C9H8Br2O4/c1-3-5(10)6(11)4(2)8(7(3)12)15-9(13)14/h12H,1-2H3,(H,13,14) |
| InChIKey | NOHKMTHNKMPIAI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.97 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (4,5-dibromo-2-hydroxy-3,6-dimethylphenyl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,5-dibromo-2-hydroxy-3,6-dimethylphenyl) hydrogen carbonate?
The IUPAC name of (4,5-dibromo-2-hydroxy-3,6-dimethylphenyl) hydrogen carbonate (CID 87859965) is (4,5-dibromo-2-hydroxy-3,6-dimethylphenyl) hydrogen carbonate.
What is the SMILES notation for (4,5-dibromo-2-hydroxy-3,6-dimethylphenyl) hydrogen carbonate?
The canonical SMILES for (4,5-dibromo-2-hydroxy-3,6-dimethylphenyl) hydrogen carbonate is Cc1c(O)c(OC(=O)O)c(C)c(Br)c1Br.
What is the InChIKey of (4,5-dibromo-2-hydroxy-3,6-dimethylphenyl) hydrogen carbonate?
The InChIKey is NOHKMTHNKMPIAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8Br2O4/c1-3-5(10)6(11)4(2)8(7(3)12)15-9(13)14/h12H,1-2H3,(H,13,14).
What are the key properties of (4,5-dibromo-2-hydroxy-3,6-dimethylphenyl) hydrogen carbonate?
(4,5-dibromo-2-hydroxy-3,6-dimethylphenyl) hydrogen carbonate has a molecular weight of 339.97 g/mol, XLogP of 3.59, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4,5-dibromo-2-hydroxy-3,6-dimethylphenyl) hydrogen carbonate is sourced from PubChem (CID 87859965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).