C33H46N2Ni — CID 87860115
2-N-(2,5-ditert-butylphenyl)-3-N-[2,6-di(propan-2-yl)phenyl]bicyclo[2.2.1]heptane-2,3-diimine;nickel (PubChem CID 87860115) has the molecular formula C33H46N2Ni and a molecular weight of 529.44 g/mol. Its IUPAC name is 2-N-(2,5-ditert-butylphenyl)-3-N-[2,6-di(propan-2-yl)phenyl]bicyclo[2.2.1]heptane-2,3-diimine;nickel.
| Compound Name | 2-N-(2,5-ditert-butylphenyl)-3-N-[2,6-di(propan-2-yl)phenyl]bicyclo[2.2.1]heptane-2,3-diimine;nickel |
|---|---|
| PubChem CID | 87860115 |
| Molecular Formula | C33H46N2Ni |
| Molecular Weight | 529.44 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | 2-N-(2,5-ditert-butylphenyl)-3-N-[2,6-di(propan-2-yl)phenyl]bicyclo[2.2.1]heptane-2,3-diimine;nickel |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C1C(=N/c2cc(C(C)(C)C)ccc2C(C)(C)C)/C2CCC/1C2.[Ni] |
| InChI | InChI=1S/C33H46N2.Ni/c1-20(2)25-12-11-13-26(21(3)4)31(25)35-30-23-15-14-22(18-23)29(30)34-28-19-24(32(5,6)7)16-17-27(28)33(8,9)10;/h11-13,16-17,19-23H,14-15,18H2,1-10H3;/b34-29+,35-30+; |
| InChIKey | PWSLDCFDGHECFR-OPYIAZERSA-N |
| XLogP | 9.80 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.44 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|