C32H46N2Ni — CID 87860206
1-N-(2,5-ditert-butylphenyl)-2-N-[2,6-di(propan-2-yl)phenyl]-3-methylcyclopentane-1,2-diimine;nickel (PubChem CID 87860206) has the molecular formula C32H46N2Ni and a molecular weight of 517.43 g/mol. Its IUPAC name is 1-N-(2,5-ditert-butylphenyl)-2-N-[2,6-di(propan-2-yl)phenyl]-3-methylcyclopentane-1,2-diimine;nickel.
| Compound Name | 1-N-(2,5-ditert-butylphenyl)-2-N-[2,6-di(propan-2-yl)phenyl]-3-methylcyclopentane-1,2-diimine;nickel |
|---|---|
| PubChem CID | 87860206 |
| Molecular Formula | C32H46N2Ni |
| Molecular Weight | 517.43 g/mol |
| Exact Mass | 516.30 |
| IUPAC Name | 1-N-(2,5-ditert-butylphenyl)-2-N-[2,6-di(propan-2-yl)phenyl]-3-methylcyclopentane-1,2-diimine;nickel |
| SMILES | CC1CCC(=N\c2cc(C(C)(C)C)ccc2C(C)(C)C)/C1=N/c1c(C(C)C)cccc1C(C)C.[Ni] |
| InChI | InChI=1S/C32H46N2.Ni/c1-20(2)24-13-12-14-25(21(3)4)30(24)34-29-22(5)15-18-27(29)33-28-19-23(31(6,7)8)16-17-26(28)32(9,10)11;/h12-14,16-17,19-22H,15,18H2,1-11H3;/b33-27+,34-29+; |
| InChIKey | OXHKOHHWSIUXJH-MXTHPCKQSA-N |
| XLogP | 9.80 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.43 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|