C10H12BF8N — CID 87860288
1-propan-2-ylpyridin-1-ium;trifluoro(1,1,2,2,2-pentafluoroethyl)boranuide (PubChem CID 87860288) has the molecular formula C10H12BF8N and a molecular weight of 309.01 g/mol. Its IUPAC name is 1-propan-2-ylpyridin-1-ium;trifluoro(1,1,2,2,2-pentafluoroethyl)boranuide.
| Compound Name | 1-propan-2-ylpyridin-1-ium;trifluoro(1,1,2,2,2-pentafluoroethyl)boranuide |
|---|---|
| PubChem CID | 87860288 |
| Molecular Formula | C10H12BF8N |
| Molecular Weight | 309.01 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 1-propan-2-ylpyridin-1-ium;trifluoro(1,1,2,2,2-pentafluoroethyl)boranuide |
| SMILES | CC(C)[n+]1ccccc1.F[B-](F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H12N.C2BF8/c1-8(2)9-6-4-3-5-7-9;4-1(5,2(6,7)8)3(9,10)11/h3-8H,1-2H3;/q+1;-1 |
| InChIKey | UOBQJNCGWUFJQN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.01 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|