About N-(2,6-diethylphenyl)-1-pyrazin-2-ylmethanimine;nickel
N-(2,6-diethylphenyl)-1-pyrazin-2-ylmethanimine;nickel (PubChem CID 87860521) has the molecular formula C15H17N3Ni
and a molecular weight of 298.02 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-1-pyrazin-2-ylmethanimine;nickel.
Molecular Properties
| Compound Name | N-(2,6-diethylphenyl)-1-pyrazin-2-ylmethanimine;nickel |
| PubChem CID | 87860521 |
| Molecular Formula | C15H17N3Ni |
| Molecular Weight | 298.02 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-(2,6-diethylphenyl)-1-pyrazin-2-ylmethanimine;nickel |
| SMILES | CCc1cccc(CC)c1/N=C/c1cnccn1.[Ni] |
| InChI | InChI=1S/C15H17N3.Ni/c1-3-12-6-5-7-13(4-2)15(12)18-11-14-10-16-8-9-17-14;/h5-11H,3-4H2,1-2H3;/b18-11+; |
| InChIKey | KBDKZMHWWBTPFZ-NWBUNABESA-N |
| XLogP | 3.35 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.02 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2,6-diethylphenyl)-1-pyrazin-2-ylmethanimine;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-diethylphenyl)-1-pyrazin-2-ylmethanimine;nickel?
The IUPAC name of N-(2,6-diethylphenyl)-1-pyrazin-2-ylmethanimine;nickel (CID 87860521) is N-(2,6-diethylphenyl)-1-pyrazin-2-ylmethanimine;nickel.
What is the SMILES notation for N-(2,6-diethylphenyl)-1-pyrazin-2-ylmethanimine;nickel?
The canonical SMILES for N-(2,6-diethylphenyl)-1-pyrazin-2-ylmethanimine;nickel is CCc1cccc(CC)c1/N=C/c1cnccn1.[Ni].
What is the InChIKey of N-(2,6-diethylphenyl)-1-pyrazin-2-ylmethanimine;nickel?
The InChIKey is KBDKZMHWWBTPFZ-NWBUNABESA-N. The full InChI is InChI=1S/C15H17N3.Ni/c1-3-12-6-5-7-13(4-2)15(12)18-11-14-10-16-8-9-17-14;/h5-11H,3-4H2,1-2H3;/b18-11+;.
What are the key properties of N-(2,6-diethylphenyl)-1-pyrazin-2-ylmethanimine;nickel?
N-(2,6-diethylphenyl)-1-pyrazin-2-ylmethanimine;nickel has a molecular weight of 298.02 g/mol, XLogP of 3.35, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-diethylphenyl)-1-pyrazin-2-ylmethanimine;nickel is sourced from PubChem (CID 87860521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).