About 3,4-dibromo-2-ethyl-5,6-dihydroxybenzoic acid
3,4-dibromo-2-ethyl-5,6-dihydroxybenzoic acid (PubChem CID 87860652) has the molecular formula C9H8Br2O4
and a molecular weight of 339.97 g/mol. Its IUPAC name is 3,4-dibromo-2-ethyl-5,6-dihydroxybenzoic acid.
Molecular Properties
| Compound Name | 3,4-dibromo-2-ethyl-5,6-dihydroxybenzoic acid |
| PubChem CID | 87860652 |
| Molecular Formula | C9H8Br2O4 |
| Molecular Weight | 339.97 g/mol |
| Exact Mass | 337.88 |
| IUPAC Name | 3,4-dibromo-2-ethyl-5,6-dihydroxybenzoic acid |
| SMILES | CCc1c(Br)c(Br)c(O)c(O)c1C(=O)O |
| InChI | InChI=1S/C9H8Br2O4/c1-2-3-4(9(14)15)7(12)8(13)6(11)5(3)10/h12-13H,2H2,1H3,(H,14,15) |
| InChIKey | BSBCLUACPBSYEO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.97 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dibromo-2-ethyl-5,6-dihydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dibromo-2-ethyl-5,6-dihydroxybenzoic acid?
The IUPAC name of 3,4-dibromo-2-ethyl-5,6-dihydroxybenzoic acid (CID 87860652) is 3,4-dibromo-2-ethyl-5,6-dihydroxybenzoic acid.
What is the SMILES notation for 3,4-dibromo-2-ethyl-5,6-dihydroxybenzoic acid?
The canonical SMILES for 3,4-dibromo-2-ethyl-5,6-dihydroxybenzoic acid is CCc1c(Br)c(Br)c(O)c(O)c1C(=O)O.
What is the InChIKey of 3,4-dibromo-2-ethyl-5,6-dihydroxybenzoic acid?
The InChIKey is BSBCLUACPBSYEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8Br2O4/c1-2-3-4(9(14)15)7(12)8(13)6(11)5(3)10/h12-13H,2H2,1H3,(H,14,15).
What are the key properties of 3,4-dibromo-2-ethyl-5,6-dihydroxybenzoic acid?
3,4-dibromo-2-ethyl-5,6-dihydroxybenzoic acid has a molecular weight of 339.97 g/mol, XLogP of 2.88, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dibromo-2-ethyl-5,6-dihydroxybenzoic acid is sourced from PubChem (CID 87860652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).