C12H22BF8N — CID 87861070
1,1-dipropylpyrrolidin-1-ium;trifluoro(1,1,2,2,2-pentafluoroethyl)boranuide (PubChem CID 87861070) has the molecular formula C12H22BF8N and a molecular weight of 343.11 g/mol. Its IUPAC name is 1,1-dipropylpyrrolidin-1-ium;trifluoro(1,1,2,2,2-pentafluoroethyl)boranuide.
| Compound Name | 1,1-dipropylpyrrolidin-1-ium;trifluoro(1,1,2,2,2-pentafluoroethyl)boranuide |
|---|---|
| PubChem CID | 87861070 |
| Molecular Formula | C12H22BF8N |
| Molecular Weight | 343.11 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 1,1-dipropylpyrrolidin-1-ium;trifluoro(1,1,2,2,2-pentafluoroethyl)boranuide |
| SMILES | CCC[N+]1(CCC)CCCC1.F[B-](F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H22N.C2BF8/c1-3-7-11(8-4-2)9-5-6-10-11;4-1(5,2(6,7)8)3(9,10)11/h3-10H2,1-2H3;/q+1;-1 |
| InChIKey | DSWMEQQLAHGMOK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.11 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|