C4HF6IO — CID 87861576
1,1,2-trifluoro-2-(1,2,2-trifluoroethenoxy)ethene;hydroiodide (PubChem CID 87861576) has the molecular formula C4HF6IO and a molecular weight of 305.94 g/mol. Its IUPAC name is 1,1,2-trifluoro-2-(1,2,2-trifluoroethenoxy)ethene;hydroiodide.
| Compound Name | 1,1,2-trifluoro-2-(1,2,2-trifluoroethenoxy)ethene;hydroiodide |
|---|---|
| PubChem CID | 87861576 |
| Molecular Formula | C4HF6IO |
| Molecular Weight | 305.94 g/mol |
| Exact Mass | 305.90 |
| IUPAC Name | 1,1,2-trifluoro-2-(1,2,2-trifluoroethenoxy)ethene;hydroiodide |
| SMILES | FC(F)=C(F)OC(F)=C(F)F.I |
| InChI | InChI=1S/C4F6O.HI/c5-1(6)3(9)11-4(10)2(7)8;/h;1H |
| InChIKey | GOPHMGMDXCGKMN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.94 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|