C11H12N2O5S — CID 87862386
1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(1-hydroxyprop-2-ynyl)thiolan-2-yl]pyrimidine-2,4-dione (PubChem CID 87862386) has the molecular formula C11H12N2O5S and a molecular weight of 284.29 g/mol. Its IUPAC name is 1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(1-hydroxyprop-2-ynyl)thiolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(1-hydroxyprop-2-ynyl)thiolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 87862386 |
| Molecular Formula | C11H12N2O5S |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(1-hydroxyprop-2-ynyl)thiolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C#CC(O)[C@H]1S[C@@H](n2ccc(=O)[nH]c2=O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H12N2O5S/c1-2-5(14)9-7(16)8(17)10(19-9)13-4-3-6(15)12-11(13)18/h1,3-5,7-10,14,16-17H,(H,12,15,18)/t5?,7-,8-,9+,10+/m0/s1 |
| InChIKey | GFKMOBJJNIVZME-BDUMLRACSA-N |
| XLogP | -2.13 |
| TPSA | 115.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|