C27H26ClF2N2O2+ — CID 87862543
[5-chloro-1-(2-phenoxyethyl)spiro[2H-indol-1-ium-3,4'-piperidine]-1-yl]-(2,6-difluorophenyl)methanone (PubChem CID 87862543) has the molecular formula C27H26ClF2N2O2+ and a molecular weight of 483.97 g/mol. Its IUPAC name is [5-chloro-1-(2-phenoxyethyl)spiro[2H-indol-1-ium-3,4'-piperidine]-1-yl]-(2,6-difluorophenyl)methanone.
| Compound Name | [5-chloro-1-(2-phenoxyethyl)spiro[2H-indol-1-ium-3,4'-piperidine]-1-yl]-(2,6-difluorophenyl)methanone |
|---|---|
| PubChem CID | 87862543 |
| Molecular Formula | C27H26ClF2N2O2+ |
| Molecular Weight | 483.97 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | [5-chloro-1-(2-phenoxyethyl)spiro[2H-indol-1-ium-3,4'-piperidine]-1-yl]-(2,6-difluorophenyl)methanone |
| SMILES | O=C(c1c(F)cccc1F)[N+]1(CCOc2ccccc2)CC2(CCNCC2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C27H26ClF2N2O2/c28-19-9-10-24-21(17-19)27(11-13-31-14-12-27)18-32(24,15-16-34-20-5-2-1-3-6-20)26(33)25-22(29)7-4-8-23(25)30/h1-10,17,31H,11-16,18H2/q+1 |
| InChIKey | LEIBCIIIMFYBFU-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.97 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|