C15H8Cl4N2 — CID 87862791
2,4,5,6-tetrachlorobenzene-1,3-dicarbonitrile;toluene (PubChem CID 87862791) has the molecular formula C15H8Cl4N2 and a molecular weight of 358.06 g/mol. Its IUPAC name is 2,4,5,6-tetrachlorobenzene-1,3-dicarbonitrile;toluene.
| Compound Name | 2,4,5,6-tetrachlorobenzene-1,3-dicarbonitrile;toluene |
|---|---|
| PubChem CID | 87862791 |
| Molecular Formula | C15H8Cl4N2 |
| Molecular Weight | 358.06 g/mol |
| Exact Mass | 355.94 |
| IUPAC Name | 2,4,5,6-tetrachlorobenzene-1,3-dicarbonitrile;toluene |
| SMILES | Cc1ccccc1.N#Cc1c(Cl)c(Cl)c(Cl)c(C#N)c1Cl |
| InChI | InChI=1S/C8Cl4N2.C7H8/c9-5-3(1-13)6(10)8(12)7(11)4(5)2-14;1-7-5-3-2-4-6-7/h;2-6H,1H3 |
| InChIKey | JJGLLEPARRUADQ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.06 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|