C30H52O2 — CID 87863923
(6R)-8,8-bis[[(3R)-3,7-dimethylocta-1,6-dien-3-yl]oxy]-2,6-dimethyloct-2-ene (PubChem CID 87863923) has the molecular formula C30H52O2 and a molecular weight of 444.74 g/mol. Its IUPAC name is (6R)-8,8-bis[[(3R)-3,7-dimethylocta-1,6-dien-3-yl]oxy]-2,6-dimethyloct-2-ene.
| Compound Name | (6R)-8,8-bis[[(3R)-3,7-dimethylocta-1,6-dien-3-yl]oxy]-2,6-dimethyloct-2-ene |
|---|---|
| PubChem CID | 87863923 |
| Molecular Formula | C30H52O2 |
| Molecular Weight | 444.74 g/mol |
| Exact Mass | 444.40 |
| IUPAC Name | (6R)-8,8-bis[[(3R)-3,7-dimethylocta-1,6-dien-3-yl]oxy]-2,6-dimethyloct-2-ene |
| SMILES | C=C[C@@](C)(CCC=C(C)C)OC(C[C@H](C)CCC=C(C)C)O[C@@](C)(C=C)CCC=C(C)C |
| InChI | InChI=1S/C30H52O2/c1-12-29(10,21-15-18-25(5)6)31-28(23-27(9)20-14-17-24(3)4)32-30(11,13-2)22-16-19-26(7)8/h12-13,17-19,27-28H,1-2,14-16,20-23H2,3-11H3/t27-,29+,30+/m1/s1 |
| InChIKey | DNRDEFFEHHOYHU-GGCFSWKVSA-N |
| XLogP | 9.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.74 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|