C5H7N3O7 — CID 87864119
1-(1,2,2,2-tetrahydroxyethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 87864119) has the molecular formula C5H7N3O7 and a molecular weight of 221.12 g/mol. Its IUPAC name is 1-(1,2,2,2-tetrahydroxyethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(1,2,2,2-tetrahydroxyethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 87864119 |
| Molecular Formula | C5H7N3O7 |
| Molecular Weight | 221.12 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 1-(1,2,2,2-tetrahydroxyethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1[nH]c(=O)n(C(O)C(O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C5H7N3O7/c9-1(5(13,14)15)8-3(11)6-2(10)7-4(8)12/h1,9,13-15H,(H2,6,7,10,11,12) |
| InChIKey | JSDVSZIBDHUBCK-UHFFFAOYSA-N |
| XLogP | -4.65 |
| TPSA | 168.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.12 |
| LogP ≤ 5 | -4.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|