About dimethyl-(oxiran-2-ylmethyl)-propylazanium;prop-2-enamide;chloride
dimethyl-(oxiran-2-ylmethyl)-propylazanium;prop-2-enamide;chloride (PubChem CID 87864128) has the molecular formula C11H23ClN2O2
and a molecular weight of 250.77 g/mol. Its IUPAC name is dimethyl-(oxiran-2-ylmethyl)-propylazanium;prop-2-enamide;chloride.
Molecular Properties
| Compound Name | dimethyl-(oxiran-2-ylmethyl)-propylazanium;prop-2-enamide;chloride |
| PubChem CID | 87864128 |
| Molecular Formula | C11H23ClN2O2 |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | dimethyl-(oxiran-2-ylmethyl)-propylazanium;prop-2-enamide;chloride |
| SMILES | C=CC(N)=O.CCC[N+](C)(C)CC1CO1.[Cl-] |
| InChI | InChI=1S/C8H18NO.C3H5NO.ClH/c1-4-5-9(2,3)6-8-7-10-8;1-2-3(4)5;/h8H,4-7H2,1-3H3;2H,1H2,(H2,4,5);1H/q+1;;/p-1 |
| InChIKey | HYHSLZZEZHHCFC-UHFFFAOYSA-M |
| XLogP | -2.47 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-(oxiran-2-ylmethyl)-propylazanium;prop-2-enamide;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-(oxiran-2-ylmethyl)-propylazanium;prop-2-enamide;chloride?
The IUPAC name of dimethyl-(oxiran-2-ylmethyl)-propylazanium;prop-2-enamide;chloride (CID 87864128) is dimethyl-(oxiran-2-ylmethyl)-propylazanium;prop-2-enamide;chloride.
What is the SMILES notation for dimethyl-(oxiran-2-ylmethyl)-propylazanium;prop-2-enamide;chloride?
The canonical SMILES for dimethyl-(oxiran-2-ylmethyl)-propylazanium;prop-2-enamide;chloride is C=CC(N)=O.CCC[N+](C)(C)CC1CO1.[Cl-].
What is the InChIKey of dimethyl-(oxiran-2-ylmethyl)-propylazanium;prop-2-enamide;chloride?
The InChIKey is HYHSLZZEZHHCFC-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H18NO.C3H5NO.ClH/c1-4-5-9(2,3)6-8-7-10-8;1-2-3(4)5;/h8H,4-7H2,1-3H3;2H,1H2,(H2,4,5);1H/q+1;;/p-1.
What are the key properties of dimethyl-(oxiran-2-ylmethyl)-propylazanium;prop-2-enamide;chloride?
dimethyl-(oxiran-2-ylmethyl)-propylazanium;prop-2-enamide;chloride has a molecular weight of 250.77 g/mol, XLogP of -2.47, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-(oxiran-2-ylmethyl)-propylazanium;prop-2-enamide;chloride is sourced from PubChem (CID 87864128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).