About (2R,3S)-2-[butyl(dimethyl)silyl]oxy-3,4-dihydroxybutanal
(2R,3S)-2-[butyl(dimethyl)silyl]oxy-3,4-dihydroxybutanal (PubChem CID 87864203) has the molecular formula C10H22O4Si
and a molecular weight of 234.37 g/mol. Its IUPAC name is (2R,3S)-2-[butyl(dimethyl)silyl]oxy-3,4-dihydroxybutanal.
Molecular Properties
| Compound Name | (2R,3S)-2-[butyl(dimethyl)silyl]oxy-3,4-dihydroxybutanal |
| PubChem CID | 87864203 |
| Molecular Formula | C10H22O4Si |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (2R,3S)-2-[butyl(dimethyl)silyl]oxy-3,4-dihydroxybutanal |
| SMILES | CCCC[Si](C)(C)O[C@@H](C=O)[C@@H](O)CO |
| InChI | InChI=1S/C10H22O4Si/c1-4-5-6-15(2,3)14-10(8-12)9(13)7-11/h8-11,13H,4-7H2,1-3H3/t9-,10-/m0/s1 |
| InChIKey | ZYQOHPQMKXWDGP-UWVGGRQHSA-N |
| XLogP | 0.93 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2R,3S)-2-[butyl(dimethyl)silyl]oxy-3,4-dihydroxybutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-2-[butyl(dimethyl)silyl]oxy-3,4-dihydroxybutanal?
The IUPAC name of (2R,3S)-2-[butyl(dimethyl)silyl]oxy-3,4-dihydroxybutanal (CID 87864203) is (2R,3S)-2-[butyl(dimethyl)silyl]oxy-3,4-dihydroxybutanal.
What is the SMILES notation for (2R,3S)-2-[butyl(dimethyl)silyl]oxy-3,4-dihydroxybutanal?
The canonical SMILES for (2R,3S)-2-[butyl(dimethyl)silyl]oxy-3,4-dihydroxybutanal is CCCC[Si](C)(C)O[C@@H](C=O)[C@@H](O)CO.
What is the InChIKey of (2R,3S)-2-[butyl(dimethyl)silyl]oxy-3,4-dihydroxybutanal?
The InChIKey is ZYQOHPQMKXWDGP-UWVGGRQHSA-N. The full InChI is InChI=1S/C10H22O4Si/c1-4-5-6-15(2,3)14-10(8-12)9(13)7-11/h8-11,13H,4-7H2,1-3H3/t9-,10-/m0/s1.
What are the key properties of (2R,3S)-2-[butyl(dimethyl)silyl]oxy-3,4-dihydroxybutanal?
(2R,3S)-2-[butyl(dimethyl)silyl]oxy-3,4-dihydroxybutanal has a molecular weight of 234.37 g/mol, XLogP of 0.93, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-2-[butyl(dimethyl)silyl]oxy-3,4-dihydroxybutanal is sourced from PubChem (CID 87864203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).