C10H22O4Si — CID 87864204
(2R,3S)-1-[butyl(dimethyl)silyl]-2,3,4-trihydroxybutan-1-one (PubChem CID 87864204) has the molecular formula C10H22O4Si and a molecular weight of 234.37 g/mol. Its IUPAC name is (2R,3S)-1-[butyl(dimethyl)silyl]-2,3,4-trihydroxybutan-1-one.
| Compound Name | (2R,3S)-1-[butyl(dimethyl)silyl]-2,3,4-trihydroxybutan-1-one |
|---|---|
| PubChem CID | 87864204 |
| Molecular Formula | C10H22O4Si |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (2R,3S)-1-[butyl(dimethyl)silyl]-2,3,4-trihydroxybutan-1-one |
| SMILES | CCCC[Si](C)(C)C(=O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C10H22O4Si/c1-4-5-6-15(2,3)10(14)9(13)8(12)7-11/h8-9,11-13H,4-7H2,1-3H3/t8-,9+/m0/s1 |
| InChIKey | FKRDNVNKTFXAQK-DTWKUNHWSA-N |
| XLogP | 0.32 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|