C21H28N2 — CID 87864246
N-(3,5-ditert-butylphenyl)-1-pyridin-3-ylethanimine (PubChem CID 87864246) has the molecular formula C21H28N2 and a molecular weight of 308.47 g/mol. Its IUPAC name is N-(3,5-ditert-butylphenyl)-1-pyridin-3-ylethanimine.
| Compound Name | N-(3,5-ditert-butylphenyl)-1-pyridin-3-ylethanimine |
|---|---|
| PubChem CID | 87864246 |
| Molecular Formula | C21H28N2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | N-(3,5-ditert-butylphenyl)-1-pyridin-3-ylethanimine |
| SMILES | C/C(=N\c1cc(C(C)(C)C)cc(C(C)(C)C)c1)c1cccnc1 |
| InChI | InChI=1S/C21H28N2/c1-15(16-9-8-10-22-14-16)23-19-12-17(20(2,3)4)11-18(13-19)21(5,6)7/h8-14H,1-7H3/b23-15+ |
| InChIKey | ZUTPGXTXDOUCOZ-HZHRSRAPSA-N |
| XLogP | 5.82 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|