About 2-methyltridec-12-enoic acid
2-methyltridec-12-enoic acid (PubChem CID 87864392) has the molecular formula C14H26O2
and a molecular weight of 226.36 g/mol. Its IUPAC name is 2-methyltridec-12-enoic acid.
Molecular Properties
| Compound Name | 2-methyltridec-12-enoic acid |
| PubChem CID | 87864392 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 2-methyltridec-12-enoic acid |
| SMILES | C=CCCCCCCCCCC(C)C(=O)O |
| InChI | InChI=1S/C14H26O2/c1-3-4-5-6-7-8-9-10-11-12-13(2)14(15)16/h3,13H,1,4-12H2,2H3,(H,15,16) |
| InChIKey | USRXRJCHJGQICX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyltridec-12-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyltridec-12-enoic acid?
The IUPAC name of 2-methyltridec-12-enoic acid (CID 87864392) is 2-methyltridec-12-enoic acid.
What is the SMILES notation for 2-methyltridec-12-enoic acid?
The canonical SMILES for 2-methyltridec-12-enoic acid is C=CCCCCCCCCCC(C)C(=O)O.
What is the InChIKey of 2-methyltridec-12-enoic acid?
The InChIKey is USRXRJCHJGQICX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O2/c1-3-4-5-6-7-8-9-10-11-12-13(2)14(15)16/h3,13H,1,4-12H2,2H3,(H,15,16).
What are the key properties of 2-methyltridec-12-enoic acid?
2-methyltridec-12-enoic acid has a molecular weight of 226.36 g/mol, XLogP of 4.40, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyltridec-12-enoic acid is sourced from PubChem (CID 87864392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).