About 2,2-difluoro-1-(1,3-thiazol-5-yl)ethanone
2,2-difluoro-1-(1,3-thiazol-5-yl)ethanone (PubChem CID 87864891) has the molecular formula C5H3F2NOS
and a molecular weight of 163.15 g/mol. Its IUPAC name is 2,2-difluoro-1-(1,3-thiazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 2,2-difluoro-1-(1,3-thiazol-5-yl)ethanone |
| PubChem CID | 87864891 |
| Molecular Formula | C5H3F2NOS |
| Molecular Weight | 163.15 g/mol |
| Exact Mass | 162.99 |
| IUPAC Name | 2,2-difluoro-1-(1,3-thiazol-5-yl)ethanone |
| SMILES | O=C(c1cncs1)C(F)F |
| InChI | InChI=1S/C5H3F2NOS/c6-5(7)4(9)3-1-8-2-10-3/h1-2,5H |
| InChIKey | AEANFRYZXNGCGZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.15 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-difluoro-1-(1,3-thiazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-1-(1,3-thiazol-5-yl)ethanone?
The IUPAC name of 2,2-difluoro-1-(1,3-thiazol-5-yl)ethanone (CID 87864891) is 2,2-difluoro-1-(1,3-thiazol-5-yl)ethanone.
What is the SMILES notation for 2,2-difluoro-1-(1,3-thiazol-5-yl)ethanone?
The canonical SMILES for 2,2-difluoro-1-(1,3-thiazol-5-yl)ethanone is O=C(c1cncs1)C(F)F.
What is the InChIKey of 2,2-difluoro-1-(1,3-thiazol-5-yl)ethanone?
The InChIKey is AEANFRYZXNGCGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3F2NOS/c6-5(7)4(9)3-1-8-2-10-3/h1-2,5H.
What are the key properties of 2,2-difluoro-1-(1,3-thiazol-5-yl)ethanone?
2,2-difluoro-1-(1,3-thiazol-5-yl)ethanone has a molecular weight of 163.15 g/mol, XLogP of 1.59, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-1-(1,3-thiazol-5-yl)ethanone is sourced from PubChem (CID 87864891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).