About 3-hydroxy-2-methylpyran-4-one;3-hydroxypyran-2-one
3-hydroxy-2-methylpyran-4-one;3-hydroxypyran-2-one (PubChem CID 87865031) has the molecular formula C11H10O6
and a molecular weight of 238.19 g/mol. Its IUPAC name is 3-hydroxy-2-methylpyran-4-one;3-hydroxypyran-2-one.
Molecular Properties
| Compound Name | 3-hydroxy-2-methylpyran-4-one;3-hydroxypyran-2-one |
| PubChem CID | 87865031 |
| Molecular Formula | C11H10O6 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 3-hydroxy-2-methylpyran-4-one;3-hydroxypyran-2-one |
| SMILES | Cc1occc(=O)c1O.O=c1occcc1O |
| InChI | InChI=1S/C6H6O3.C5H4O3/c1-4-6(8)5(7)2-3-9-4;6-4-2-1-3-8-5(4)7/h2-3,8H,1H3;1-3,6H |
| InChIKey | MNBSJPBCHJAIFE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-hydroxy-2-methylpyran-4-one;3-hydroxypyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2-methylpyran-4-one;3-hydroxypyran-2-one?
The IUPAC name of 3-hydroxy-2-methylpyran-4-one;3-hydroxypyran-2-one (CID 87865031) is 3-hydroxy-2-methylpyran-4-one;3-hydroxypyran-2-one.
What is the SMILES notation for 3-hydroxy-2-methylpyran-4-one;3-hydroxypyran-2-one?
The canonical SMILES for 3-hydroxy-2-methylpyran-4-one;3-hydroxypyran-2-one is Cc1occc(=O)c1O.O=c1occcc1O.
What is the InChIKey of 3-hydroxy-2-methylpyran-4-one;3-hydroxypyran-2-one?
The InChIKey is MNBSJPBCHJAIFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O3.C5H4O3/c1-4-6(8)5(7)2-3-9-4;6-4-2-1-3-8-5(4)7/h2-3,8H,1H3;1-3,6H.
What are the key properties of 3-hydroxy-2-methylpyran-4-one;3-hydroxypyran-2-one?
3-hydroxy-2-methylpyran-4-one;3-hydroxypyran-2-one has a molecular weight of 238.19 g/mol, XLogP of 1.00, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2-methylpyran-4-one;3-hydroxypyran-2-one is sourced from PubChem (CID 87865031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).