C31H34N4O4S — CID 87865374
(E)-N-(2-aminophenyl)-3-[1-[4-phenyl-1-(2-pyrrolidin-1-ylethoxy)cyclohexa-2,4-dien-1-yl]sulfonylpyrrol-3-yl]prop-2-enamide (PubChem CID 87865374) has the molecular formula C31H34N4O4S and a molecular weight of 558.70 g/mol. Its IUPAC name is (E)-N-(2-aminophenyl)-3-[1-[4-phenyl-1-(2-pyrrolidin-1-ylethoxy)cyclohexa-2,4-dien-1-yl]sulfonylpyrrol-3-yl]prop-2-enamide.
| Compound Name | (E)-N-(2-aminophenyl)-3-[1-[4-phenyl-1-(2-pyrrolidin-1-ylethoxy)cyclohexa-2,4-dien-1-yl]sulfonylpyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 87865374 |
| Molecular Formula | C31H34N4O4S |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | (E)-N-(2-aminophenyl)-3-[1-[4-phenyl-1-(2-pyrrolidin-1-ylethoxy)cyclohexa-2,4-dien-1-yl]sulfonylpyrrol-3-yl]prop-2-enamide |
| SMILES | Nc1ccccc1NC(=O)/C=C/c1ccn(S(=O)(=O)C2(OCCN3CCCC3)C=CC(c3ccccc3)=CC2)c1 |
| InChI | InChI=1S/C31H34N4O4S/c32-28-10-4-5-11-29(28)33-30(36)13-12-25-16-21-35(24-25)40(37,38)31(39-23-22-34-19-6-7-20-34)17-14-27(15-18-31)26-8-2-1-3-9-26/h1-5,8-17,21,24H,6-7,18-20,22-23,32H2,(H,33,36)/b13-12+ |
| InChIKey | JLPGRSJWMRUEQI-OUKQBFOZSA-N |
| XLogP | 4.75 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|