About 1,3,6-triiodo-5-methylpyrimidine-2,4-dione
1,3,6-triiodo-5-methylpyrimidine-2,4-dione (PubChem CID 87865756) has the molecular formula C5H3I3N2O2
and a molecular weight of 503.80 g/mol. Its IUPAC name is 1,3,6-triiodo-5-methylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1,3,6-triiodo-5-methylpyrimidine-2,4-dione |
| PubChem CID | 87865756 |
| Molecular Formula | C5H3I3N2O2 |
| Molecular Weight | 503.80 g/mol |
| Exact Mass | 503.73 |
| IUPAC Name | 1,3,6-triiodo-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1c(I)n(I)c(=O)n(I)c1=O |
| InChI | InChI=1S/C5H3I3N2O2/c1-2-3(6)9(7)5(12)10(8)4(2)11/h1H3 |
| InChIKey | NSKASUUTOHXTGG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 503.80 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,3,6-triiodo-5-methylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,6-triiodo-5-methylpyrimidine-2,4-dione?
The IUPAC name of 1,3,6-triiodo-5-methylpyrimidine-2,4-dione (CID 87865756) is 1,3,6-triiodo-5-methylpyrimidine-2,4-dione.
What is the SMILES notation for 1,3,6-triiodo-5-methylpyrimidine-2,4-dione?
The canonical SMILES for 1,3,6-triiodo-5-methylpyrimidine-2,4-dione is Cc1c(I)n(I)c(=O)n(I)c1=O.
What is the InChIKey of 1,3,6-triiodo-5-methylpyrimidine-2,4-dione?
The InChIKey is NSKASUUTOHXTGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3I3N2O2/c1-2-3(6)9(7)5(12)10(8)4(2)11/h1H3.
What are the key properties of 1,3,6-triiodo-5-methylpyrimidine-2,4-dione?
1,3,6-triiodo-5-methylpyrimidine-2,4-dione has a molecular weight of 503.80 g/mol, XLogP of 1.32, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,6-triiodo-5-methylpyrimidine-2,4-dione is sourced from PubChem (CID 87865756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).